Introduction:Basic information about CAS 83784-20-7|Hydrocortisone succinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hydrocortisone succinate |
|---|
| CAS Number | 83784-20-7 | Molecular Weight | 462.533 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 685.5±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H36O9 | Melting Point | >195°C (dec.) (lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 231.1±25.0 °C |
|---|
Names
| Name | 4-[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid,hydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 685.5±55.0 °C at 760 mmHg |
|---|
| Melting Point | >195°C (dec.) (lit.) |
|---|
| Molecular Formula | C25H36O9 |
|---|
| Molecular Weight | 462.533 |
|---|
| Flash Point | 231.1±25.0 °C |
|---|
| Exact Mass | 462.225372 |
|---|
| PSA | 147.43000 |
|---|
| LogP | 2.13 |
|---|
| Vapour Pressure | 0.0±4.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | AFLWPAGYTPJSEY-CODXZCKSSA-N |
|---|
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)COC(=O)CCC(=O)O.O |
|---|
| Storage condition | 20°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
Synonyms
| Cortisol 21-(Hydrogen Succinate) |
| cortisol succinate |
| UNII-LIU00Z1Z84 |
| hydrocortisone hemisuccinate |
| Butanedioic acid, mono[(11β)-11,17-dihydroxy-3,20-dioxopregn-4-en-21-yl] ester |
| LIU00Z1Z84 |
| Hydrocortisone hemisuccinate (USP) |
| (11b)-21-(3-Carboxy-1-oxopropoxy)-11,17-dihydroxypreg-4-ene-3,20-dione |
| 4-{[(11β)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl]oxy}-4-oxobutanoic acid |
| Hydrocortisone succinate |
| Hydrocortisone hemisuccinate [USAN] |
| Hydrocortisone hemisuccinate hydrate |