Introduction：Basic information about CAS 199328-10-4|Methyl oxindole-5-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl oxindole-5-carboxylate |
|---|
| CAS Number | 199328-10-4 | Molecular Weight | 191.183 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 405.6±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9NO3 | Melting Point | 192-199ºC |
|---|
| MSDS | / | Flash Point | 199.1±28.7 °C |
|---|
Names
| Name | methyl 2-oxo-1,3-dihydroindole-5-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 405.6±45.0 °C at 760 mmHg |
|---|
| Melting Point | 192-199ºC |
|---|
| Molecular Formula | C10H9NO3 |
|---|
| Molecular Weight | 191.183 |
|---|
| Flash Point | 199.1±28.7 °C |
|---|
| Exact Mass | 191.058243 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 1.86 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | CYBPPDZFRDSSME-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc2c(c1)CC(=O)N2 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| HS Code | 2933790090 |
|---|
Customs
| HS Code | 2933790090 |
|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
|---|
Synonyms
| Methyl 2-oxindole-5-carboxylate |
| methyl 2-indolinone-5-carboxylate |
| 1H-Indole-5-carboxylic acid, 2,3-dihydro-2-oxo-, methyl ester |
| methyl 2-oxoindoline-5-carboxylate |
| 5-methoxycarbonyl-2-oxindole |
| Methyl Oxindole-5-carboxylate |
| Methyl 2,3-dihydro-2-oxo-1H-indole-5-carboxylate |
| methyl 2-oxo-2,3-dihydro-1H-indole-5-carboxylate |
| 5-methoxycarbonyl-2-indolinone |
| methyl indolin-2-one-5-carboxylate |
| MFCD02179600 |
| Methyl 2-oxo-5-indolinecarboxylate |
| 2-oxo-2,3-dihydro-1H-indole-5-carboxylic acid methyl ester |
| Nintedanib Impurity 11 |
