Introduction:Basic information about CAS 117976-91-7|Desmethyl rabeprazole thioether, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Desmethyl rabeprazole thioether |
|---|
| CAS Number | 117976-91-7 | Molecular Weight | 329.41700 |
|---|
| Density | 1.32 | Boiling Point | 572.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H19N3O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 300.1ºC |
|---|
Names
| Name | 3-[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methylpyridin-4-yl]oxypropan-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.32 |
|---|
| Boiling Point | 572.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H19N3O2S |
|---|
| Molecular Weight | 329.41700 |
|---|
| Flash Point | 300.1ºC |
|---|
| Exact Mass | 329.12000 |
|---|
| PSA | 96.33000 |
|---|
| LogP | 3.31980 |
|---|
| Vapour Pressure | 6.01E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.673 |
|---|
| InChIKey | WKTPBAPTLLDMKZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(OCCCO)ccnc1CSc1nc2ccccc2[nH]1 |
|---|
Synonyms
| Demethyl-Rabeprazole Thioether |
| Desmethyl rabeprazole thioether |
| 1-Propanol,3-[[2-[(1H-benzimidazol-2-ylthio)methyl]-3-methyl-4-pyridinyl]oxy] |
| 2-[{4-(3-hydroxypropoxy)-3-methylpyridin-2-yl}methylthio]-1H-benzimidazole |
| 2-[{4-(3-hydroxypropoxy)-3-methylpyridine-2-yl}methylthio]-1H-benzimidazole |