Introduction：Basic information about CAS 154802-74-1|Cbz-D-Cyclohexylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cbz-D-Cyclohexylalanine |
|---|
| CAS Number | 154802-74-1 | Molecular Weight | 305.369 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 501.4±43.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H23NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 257.1±28.2 °C |
|---|
Names
| Name | z-d-cha-oh |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 501.4±43.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H23NO4 |
|---|
| Molecular Weight | 305.369 |
|---|
| Flash Point | 257.1±28.2 °C |
|---|
| Exact Mass | 305.162720 |
|---|
| PSA | 49.33000 |
|---|
| LogP | 4.30 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | MNABZONTQXNLDT-OAHLLOKOSA-N |
|---|
| SMILES | O=C(NC(CC1CCCCC1)C(=O)O)OCc1ccccc1 |
|---|
Synonyms
| (S)-2-(Cyclohexylamino)propanoic acid |
| N-[(Benzyloxy)carbonyl]-3-cyclohexyl-D-alanine |
| z-3-cyclohexyl-d-alanine |
| N-Cyclohexylalanine |
| l-cyclohexylalanine |
| z-d-cyclohexylalanine |
| cbz-d-cyclohexylalanine |
| Cyclohexanepropanoic acid, α-[[(phenylmethoxy)carbonyl]amino]-, (αR)- |
| (S)-Cyclohexylalanine |
| cyclohexylalanine |
| (S)-(+)-Cyclohexylalanine |
| (2S)-2-(cyclohexylamino)propanoic acid |
| L-alanine, N-cyclohexyl- |
| Alanine, N-cyclohexyl- |
