Introduction：Basic information about CAS 21467-12-9|Z-Ala-Asn-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Ala-Asn-OH |
|---|
| CAS Number | 21467-12-9 | Molecular Weight | 337.32800 |
|---|
| Density | 1.337 g/cm3 | Boiling Point | 714.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H19N3O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 385.7ºC |
|---|
Names
| Name | 4-amino-4-oxo-2-[2-(phenylmethoxycarbonylamino)propanoylamino]butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.337 g/cm3 |
|---|
| Boiling Point | 714.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H19N3O6 |
|---|
| Molecular Weight | 337.32800 |
|---|
| Flash Point | 385.7ºC |
|---|
| Exact Mass | 337.12700 |
|---|
| PSA | 147.82000 |
|---|
| LogP | 1.22820 |
|---|
| Vapour Pressure | 2.1E-21mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | HGTVLMHRWVJWOV-UHFFFAOYSA-N |
|---|
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NC(CC(N)=O)C(=O)O |
|---|
Synonyms
| N-Benzyloxycarbonyl-L-alanyl-L-asparagin |
| Cbz-Ala-Asn-OH |
| Z-Ala-Asn-OH |
