Introduction：Basic information about CAS 2043-38-1|Buthiazide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Buthiazide |
|---|
| CAS Number | 2043-38-1 | Molecular Weight | 353.84500 |
|---|
| Density | 1.433g/cm3 | Boiling Point | 562.7ºC at 760mmHg |
|---|
| Molecular Formula | C11H16ClN3O4S2 | Melting Point | 214-217ºC |
|---|
| MSDS | / | Flash Point | 294.1ºC |
|---|
Names
| Name | 6-chloro-3-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.433g/cm3 |
|---|
| Boiling Point | 562.7ºC at 760mmHg |
|---|
| Melting Point | 214-217ºC |
|---|
| Molecular Formula | C11H16ClN3O4S2 |
|---|
| Molecular Weight | 353.84500 |
|---|
| Flash Point | 294.1ºC |
|---|
| Exact Mass | 353.02700 |
|---|
| PSA | 135.12000 |
|---|
| LogP | 4.39210 |
|---|
| Vapour Pressure | 1.09E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | HGBFRHCDYZJRAO-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)CC1Nc2cc(Cl)c(S(N)(=O)=O)cc2S(=O)(=O)N1 |
|---|
Synonyms
| 6-chloro-3,4-dihydro-3-(2-methylpropyl)-2H-1,2,4-benzothiadiazine-7-sulfonamide |
| Buthiazide |
| Saltucin |
| Eunephran |
| Butizidum [INN-Latin] |
| BUTHIAZIDE |
| thiabutazide |
| Butizida |
| isobutylhydrochlorothiazide |
