Introduction:Basic information about CAS 355-20-4|Butane,2,3-dichloro-1,1,1,2,3,4,4,4-octafluoro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butane,2,3-dichloro-1,1,1,2,3,4,4,4-octafluoro- |
|---|
| CAS Number | 355-20-4 | Molecular Weight | 270.93600 |
|---|
| Density | 1.719 g/cm3 | Boiling Point | 63 °C |
|---|
| Molecular Formula | C4Cl2F8 | Melting Point | -68 °C |
|---|
| MSDS | / | Flash Point | 62-63°C |
|---|
Names
| Name | 2,3-dichlorooctafluorobutane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.719 g/cm3 |
|---|
| Boiling Point | 63 °C |
|---|
| Melting Point | -68 °C |
|---|
| Molecular Formula | C4Cl2F8 |
|---|
| Molecular Weight | 270.93600 |
|---|
| Flash Point | 62-63°C |
|---|
| Exact Mass | 269.92500 |
|---|
| LogP | 3.92020 |
|---|
| Index of Refraction | 1.313 |
|---|
| InChIKey | LXANZHXWGZWFAC-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(Cl)C(F)(Cl)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2,3-dichloro-1,1,1,2,3,4,4,4-octa-fluorobutane |
| 2,3-Dichlor-octafluor-butan |
| 2,3-dichloro-octafluoro-butane |
| MFCD00018064 |
| 2,3-chloro-octafluorobutane |
| CFC-318mbb |
| 2,3-dichloroperfluorobutane |
| Butane,2,3-dichloro-1,1,1,2,3,4,4,4-octafluoro |
| EINECS 206-578-2 |