Introduction:Basic information about CAS 38972-89-3|Z-Tyr-Val-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Tyr-Val-OH |
|---|
| CAS Number | 38972-89-3 | Molecular Weight | 414.45200 |
|---|
| Density | 1.265g/cm3 | Boiling Point | 720.7ºC at 760 mmHg |
|---|
| Molecular Formula | C22H26N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 389.7ºC |
|---|
Names
| Name | 2-[[3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-methylbutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.265g/cm3 |
|---|
| Boiling Point | 720.7ºC at 760 mmHg |
|---|
| Molecular Formula | C22H26N2O6 |
|---|
| Molecular Weight | 414.45200 |
|---|
| Flash Point | 389.7ºC |
|---|
| Exact Mass | 414.17900 |
|---|
| PSA | 124.96000 |
|---|
| LogP | 3.23690 |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | UQGCYZMRZVUJAC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)OCc1ccccc1)C(=O)O |
|---|
Synonyms
| N-carbobenzyloxy-l-tyrosyl-l-valine |
| 2-[[3-(4-hydroxyphenyl)-2-phenylmethoxycarbonylamino-propanoyl]amino]-3-methyl-butanoic acid |
| Z-Tyr-Val-OH |