Introduction：Basic information about CAS 914349-81-8|1-(4-chloro-3-isocyanatobenzenesulfonyl)-1,2,3,4-tetrahydroquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-chloro-3-isocyanatobenzenesulfonyl)-1,2,3,4-tetrahydroquinoline |
|---|
| CAS Number | 914349-81-8 | Molecular Weight | 348.80400 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 504.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13ClN2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 258.8ºC |
|---|
Names
| Name | 1-(4-chloro-3-isocyanatobenzenesulfonyl)-1,2,3,4-tetrahydroquinoline |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 504.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13ClN2O3S |
|---|
| Molecular Weight | 348.80400 |
|---|
| Flash Point | 258.8ºC |
|---|
| Exact Mass | 348.03400 |
|---|
| PSA | 75.19000 |
|---|
| LogP | 4.59460 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | BRUPJCNFXFDDRU-UHFFFAOYSA-N |
|---|
| SMILES | O=C=Nc1cc(S(=O)(=O)N2CCCc3ccccc32)ccc1Cl |
|---|
