Introduction：Basic information about CAS 197638-83-8|1-Boc-4-(4-Formylphenyl)piperazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Boc-4-(4-Formylphenyl)piperazine |
|---|
| CAS Number | 197638-83-8 | Molecular Weight | 290.358 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 441.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H22N2O3 | Melting Point | 118-121ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 220.8±27.3 °C |
|---|
| Symbol |
GHS06 | Signal Word | Danger |
|---|
Names
| Name | tert-butyl 4-(4-formylphenyl)piperazine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 441.4±40.0 °C at 760 mmHg |
|---|
| Melting Point | 118-121ºC(lit.) |
|---|
| Molecular Formula | C16H22N2O3 |
|---|
| Molecular Weight | 290.358 |
|---|
| Flash Point | 220.8±27.3 °C |
|---|
| Exact Mass | 290.163055 |
|---|
| PSA | 49.85000 |
|---|
| LogP | 1.74 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | KHORERZDMJTBMR-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C=O)cc2)CC1 |
|---|
Safety Information
| Symbol |
GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H317 |
|---|
| Precautionary Statements | P280-P301 + P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T: Toxic; |
|---|
| Risk Phrases | R25 |
|---|
| Safety Phrases | S36/37 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-(4-formylphenyl)piperazine-1-carboxylic acid tert-butyl ester |
| tert-Butyl-4-(4-formylphenyl)piperazin-1-carboxylat |
| tert-butyl 4-(4-formylphenyl)tetrahydro-1(2H)-pyrazinecarboxylate |
| 1-Boc-4-(4-formylphenyl)piperazine |
| 4-(4-tert-Butoxycarbonyl)piperazinebenzaldehyde |
| 4-[4-(t-butoxycarbonyl)piperazin-1-yl]benzaldehyde |
| 4-(4-(1,1-dimethylethoxycarbonyl)piperazinyl)benzaldehyde |
| tert-Butyl 4-(4-formylphenyl)piperazine-1-carboxylate |
| 4-(4-tert-Butoxycarbonylpiperazin-1-yl)benzaldehyde |
| 1-Piperazinecarboxylic acid, 4-(4-formylphenyl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 4-(4-formylphenyl)-1-piperazinecarboxylate |
