Introduction:Basic information about CAS 6861-83-2|4-hydroxy-[1,6]naphthyridine-3-carboxylic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-hydroxy-[1,6]naphthyridine-3-carboxylic acid ethyl ester |
|---|
| CAS Number | 6861-83-2 | Molecular Weight | 218.20900 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 359.453ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 171.191ºC |
|---|
Names
| Name | 4-hydroxy-[1,6]naphthyridine-3-carboxylic acid ethyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 359.453ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10N2O3 |
|---|
| Molecular Weight | 218.20900 |
|---|
| Flash Point | 171.191ºC |
|---|
| Exact Mass | 218.06900 |
|---|
| PSA | 72.31000 |
|---|
| LogP | 1.51210 |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | DAYVNSVJVHCJAV-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1c[nH]c2ccncc2c1=O |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-Hydroxy-3-ethoxycarbonyl-1,6-naphtiridin |
| ethyl 4-hydrazino-2-trifluoromethylpyrimidine-5-carboxylate |
| ethyl thieno[3,2-b]pyrrole-5-carboxylate |
| 4-oxo-1,4-dihydro-[1,6]naphthyridine-3-carboxylic acid ethyl ester |
| ethyl 4-hydroxy-1,6-naphthyridine-3-carboxylate |
| 4-Hydroxy-1,6-Naphthyridine-3-carboxylic Acid Ethyl Ester |
| ethyl thieno<ethyl thiopheno[2,3-d]pyrrole-5-carboxylate |
| ethylthienobpyrrolecarboxylate |
| 4-Hydrazino-2-trifluormethyl-pyrimidin-carbonsaeure-(5)-ethylester |
| Ethyl 4H-Thieno[2,3-d]Pyrrole-5-Carboxylate |
| 4-Hydroxy-3-ethoxycarbonyl-1,6-naphthyridin |
| 4H-thieno[3,2-b]pyrrole-5-carboxylic acid ethyl ester |
| Ethyl 4H-thieno[3,2-b]pyrrole5-carboxylate |
| 4-hydrazino-2-trifluoromethyl-pyrimidine-5-carboxylic acid ethyl ester |