Introduction：Basic information about CAS 21160-50-9|2-(4-Bromophenyl)-1,3-thiazole-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-Bromophenyl)-1,3-thiazole-4-carboxylic acid |
|---|
| CAS Number | 21160-50-9 | Molecular Weight | 284.129 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 457.9±51.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6BrNO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.8±30.4 °C |
|---|
Names
| Name | 2-(4-bromophenyl)-1,3-thiazole-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 457.9±51.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6BrNO2S |
|---|
| Molecular Weight | 284.129 |
|---|
| Flash Point | 230.8±30.4 °C |
|---|
| Exact Mass | 282.930267 |
|---|
| PSA | 78.43000 |
|---|
| LogP | 3.86 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | FSXGZVXOAJEGDR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1csc(-c2ccc(Br)cc2)n1 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 2-(4-Bromophenyl)-1,3-thiazole-4-carboxylic acid |
| 2-p-Brom-phenyl-thiazol-4-carbonsaeure |
| 2-(4-Bromophenyl)thiazole-4-carboxylic acid |
| 2-(4-bromophenyl)-4-thiazolecarboxylic acid |
| 2-(4'-Bromphenyl)-4-carboxy-thiazol |
| 4-Thiazolecarboxylic acid, 2-(4-bromophenyl)- |
| 2-(2-CHLOROPHENOXY)ACETAMIDE |
