Introduction：Basic information about CAS 590354-46-4|ART-CHEM-BB B018020, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ART-CHEM-BB B018020 |
|---|
| CAS Number | 590354-46-4 | Molecular Weight | 249.33200 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 357ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15N3OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.7ºC |
|---|
Names
| Name | 4-ethyl-3-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 357ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15N3OS |
|---|
| Molecular Weight | 249.33200 |
|---|
| Flash Point | 169.7ºC |
|---|
| Exact Mass | 249.09400 |
|---|
| PSA | 78.74000 |
|---|
| LogP | 2.18610 |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | CSMPQKIFNWIWBE-UHFFFAOYSA-N |
|---|
| SMILES | CCn1c(Cc2ccc(OC)cc2)n[nH]c1=S |
|---|
Safety Information
