Introduction：Basic information about CAS 21934-68-9|6'-(Diethylamino)-1',3'-dimethylfluoran, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6'-(Diethylamino)-1',3'-dimethylfluoran |
|---|
| CAS Number | 21934-68-9 | Molecular Weight | 399.482 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 592.3±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H25NO3 | Melting Point | 170ºC |
|---|
| MSDS | / | Flash Point | 312.0±30.1 °C |
|---|
Names
| Name | 6'-(diethylamino)-1',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 592.3±50.0 °C at 760 mmHg |
|---|
| Melting Point | 170ºC |
|---|
| Molecular Formula | C26H25NO3 |
|---|
| Molecular Weight | 399.482 |
|---|
| Flash Point | 312.0±30.1 °C |
|---|
| Exact Mass | 399.183441 |
|---|
| PSA | 38.77000 |
|---|
| LogP | 6.35 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.660 |
|---|
| InChIKey | XUFBVJQHCCCPNM-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(C)cc(C)c1C21OC(=O)c2ccccc21 |
|---|
Preparation
Synonyms
| EINECS 244-667-8 |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 6'-(diethylamino)-1',3'-dimethyl- |
| D3202 |
| 6'-(Diethylamino)-1',3'-dimethylspiro(isobenzofuran-1(3H),9'-(9H)xanthene)-3-one |
| Spiro(isobenzofuran-1(3H),9'-(9H)xanthen)-3-one, 6'-(diethylamino)-1',3'-dimethyl- |
| 6'-(Diethylamino)-1',3'-dimethylfluoran |
| 6'-(Diethylamino)-1',3'-dimethyl-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
