Introduction：Basic information about CAS 959580-94-0|(S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(2,4,5-trifluorophenyl)bu, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|
| CAS Number | 959580-94-0 | Molecular Weight | 455.426 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 630.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H20F3NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 334.9±31.5 °C |
|---|
Names
| Name | (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 630.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H20F3NO4 |
|---|
| Molecular Weight | 455.426 |
|---|
| Flash Point | 334.9±31.5 °C |
|---|
| Exact Mass | 455.134430 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 5.79 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | FKTSFHXFCVESHF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC(Cc1cc(F)c(F)cc1F)NC(=O)OCC1c2ccccc2-c2ccccc21 |
|---|
Synonyms
| (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-(2,4,5-trifluorophenyl)butanoic acid |
| FMOC-(S)-3-AMINO-4-(2,4,5-TRIFLUORO-PHENYL)-BUTYRICACID |
| (S)-3-(Fmoc-amino)-4-(2,4,5-trifluorophenyl)butanoic acid |
| Benzenebutanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2,4,5-trifluoro-, (βS)- |
