Introduction：Basic information about CAS 15784-35-7|2-(4-nitro-1,3-dioxo-isoindol-2-yl)acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-nitro-1,3-dioxo-isoindol-2-yl)acetate |
|---|
| CAS Number | 15784-35-7 | Molecular Weight | 250.16400 |
|---|
| Density | 1.706g/cm3 | Boiling Point | 517.7ºC at 760mmHg |
|---|
| Molecular Formula | C10H6N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 266.9ºC |
|---|
Names
| Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.706g/cm3 |
|---|
| Boiling Point | 517.7ºC at 760mmHg |
|---|
| Molecular Formula | C10H6N2O6 |
|---|
| Molecular Weight | 250.16400 |
|---|
| Flash Point | 266.9ºC |
|---|
| Exact Mass | 250.02300 |
|---|
| PSA | 120.50000 |
|---|
| LogP | 0.73650 |
|---|
| Vapour Pressure | 1.53E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.674 |
|---|
| InChIKey | VEVGTTUIMHJYSO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-Nitrophthalic Acid Anhydride |
| nitro-phthalic anhydride |
| mononitrophthalic anhydride |
| 4-nitro-2-benzofuran-1,3-dione |
| 3-nitro-phthalic anhydride |
| 3-nitrophthalimidoacetic acid |
| 4-nitroisobenzofuran-1,3-dione |
| 3-nitrophthaloylglycine |
| 4-nitro-3-isobenzofurandione |
| Phthalic anhydride,3-nitro |
| 3-Isobenzofurandione,4-nitro-1 |
