Introduction：Basic information about CAS 42471-43-2|Urea,N-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-N'-(2-chloroethyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Urea,N-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-N'-(2-chloroethyl)- |
|---|
| CAS Number | 42471-43-2 | Molecular Weight | 243.69300 |
|---|
| Density | 1.307g/cm3 | Boiling Point | 523.4ºC at 760mmHg |
|---|
| Molecular Formula | C9H14ClN5O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 270.3ºC |
|---|
Names
| Name | 1-[(4-amino-2-methylpyrimidin-5-yl)methyl]-3-(2-chloroethyl)urea |
|---|
Chemical & Physical Properties
| Density | 1.307g/cm3 |
|---|
| Boiling Point | 523.4ºC at 760mmHg |
|---|
| Molecular Formula | C9H14ClN5O |
|---|
| Molecular Weight | 243.69300 |
|---|
| Flash Point | 270.3ºC |
|---|
| Exact Mass | 243.08900 |
|---|
| PSA | 92.93000 |
|---|
| LogP | 1.76820 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | AKMQXFBFIPHWHT-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ncc(CNC(=O)NCCCl)c(N)n1 |
|---|
