Introduction:Basic information about CAS 3070-86-8|Acetamide,N,N'-(oxydi-4,1-phenylene)bis- (9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamide,N,N'-(oxydi-4,1-phenylene)bis- (9CI) |
|---|
| CAS Number | 3070-86-8 | Molecular Weight | 284.31000 |
|---|
| Density | 1.256g/cm3 | Boiling Point | 554.4ºC at 760mmHg |
|---|
| Molecular Formula | C16H16N2O3 | Melting Point | 230-231ºC(lit.) |
|---|
| MSDS | / | Flash Point | 289.1ºC |
|---|
Names
| Name | N-[4-(4-acetamidophenoxy)phenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.256g/cm3 |
|---|
| Boiling Point | 554.4ºC at 760mmHg |
|---|
| Melting Point | 230-231ºC(lit.) |
|---|
| Molecular Formula | C16H16N2O3 |
|---|
| Molecular Weight | 284.31000 |
|---|
| Flash Point | 289.1ºC |
|---|
| Exact Mass | 284.11600 |
|---|
| PSA | 67.43000 |
|---|
| LogP | 3.54170 |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | BUGCHAIWUSBYIZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(Oc2ccc(NC(C)=O)cc2)cc1 |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| n,n'-(oxydibenzene-4,1-diyl)diacetamide |
| N,N'-(Oxydi-4,1-phenylene)bisacetamide |
| bis(4-acetylaminophenyl) ether |
| N-[4-(4-acetylaminophenoxy)phenyl]acetamide |
| 4,4'-Oxybisacetanilide |
| 4,4'-diacetamido-diphenyl ether |
| Bis(p-acetylaminophenyl) ether |
| MFCD00050458 |
| N,N'-Diacetyl-4,4'-diaminodiphenyl ether |