Introduction：Basic information about CAS 55315-12-3|1,2-Benzenediamine,4-nitro-N1-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-Benzenediamine,4-nitro-N1-phenyl- |
|---|
| CAS Number | 55315-12-3 | Molecular Weight | 229.23500 |
|---|
| Density | 1.351g/cm3 | Boiling Point | 424.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 210.7ºC |
|---|
Names
| Name | 4-nitro-1-N-phenylbenzene-1,2-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.351g/cm3 |
|---|
| Boiling Point | 424.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11N3O2 |
|---|
| Molecular Weight | 229.23500 |
|---|
| Flash Point | 210.7ºC |
|---|
| Exact Mass | 229.08500 |
|---|
| PSA | 83.87000 |
|---|
| LogP | 4.09800 |
|---|
| Index of Refraction | 1.711 |
|---|
| InChIKey | PQMGRVXQAFKVMO-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc([N+](=O)[O-])ccc1Nc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-amino-4-nitro-N1-phenylaniline |
| 4-nitro-N1-phenyl-o-phenylenediamine |
| 2-Phenylamino-5-nitroaniline |
| 4-Nitro-2-amino-diphenylamin |
| 4-Nitro-N1-phenyl-o-phenylendiamin |
| 2-amino-4-nitrodiphenylamine |
