Introduction：Basic information about CAS 57688-24-1|3-bromo-2-hydroxy-5-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-bromo-2-hydroxy-5-nitrobenzoic acid |
|---|
| CAS Number | 57688-24-1 | Molecular Weight | 262.01400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C7H4BrNO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-bromo-2-hydroxy-5-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C7H4BrNO5 |
|---|
| Molecular Weight | 262.01400 |
|---|
| Exact Mass | 260.92700 |
|---|
| PSA | 103.35000 |
|---|
| LogP | 2.28430 |
|---|
| InChIKey | GHJLCCLHTCSRCE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc(Br)c1O |
|---|
Safety Information
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-bromo-2-hydroxy-5-nitrobenzenecarboxylic acid |
| bromohydroxynitrobenzenecarboxylicacid |
| 3-bromo-2-hydroxy-5-nitro-benzoic acid |
| 3-Brom-2-hydroxy-5-nitro-benzoesaeure |
| 3-Brom-5-nitro-salicylsaeure |
