Introduction:Basic information about CAS 115549-05-8|2,3,4-Trichloro-5-fluorobenzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,4-Trichloro-5-fluorobenzoyl chloride |
|---|
| CAS Number | 115549-05-8 | Molecular Weight | 261.893 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 282.2±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7HCl4FO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 124.5±25.9 °C |
|---|
Names
| Name | 2,3,4-Trichloro-5-fluorobenzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 282.2±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7HCl4FO |
|---|
| Molecular Weight | 261.893 |
|---|
| Flash Point | 124.5±25.9 °C |
|---|
| Exact Mass | 259.876556 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.58 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.570 |
|---|
| InChIKey | WXAUBUZVERZUSH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cc(F)c(Cl)c(Cl)c1Cl |
|---|
Synonyms
| 2,3,4-Trichloro-5-fluorobenzoic chloride |
| Benzoyl chloride, 2,3,4-trichloro-5-fluoro- |
| 2,3,4-Trichloro-5-fluorobenzoyl chloride |
| Benzoyl chloride,2,3,4-trichloro-5-fluoro |