Introduction：Basic information about CAS 116-28-9|huperzine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | huperzine |
|---|
| CAS Number | 116-28-9 | Molecular Weight | 242.31600 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 500.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 256.6ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 500.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18N2O |
|---|
| Molecular Weight | 242.31600 |
|---|
| Flash Point | 256.6ºC |
|---|
| Exact Mass | 242.14200 |
|---|
| PSA | 58.88000 |
|---|
| LogP | 2.69780 |
|---|
| Vapour Pressure | 3.73E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | APLHEOBEIBHCHW-UHFFFAOYSA-N |
|---|
| SMILES | CC=C1C2CC(C)=CC1(N)c1ccc(=O)[nH]c1C2 |
|---|
