Introduction：Basic information about CAS 352-13-6|4-Fluorophenylmagnesium bromide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Fluorophenylmagnesium bromide |
|---|
| CAS Number | 352-13-6 | Molecular Weight | 199.303 |
|---|
| Density | 1.043 g/mL at 25ºC | Boiling Point | 66ºC |
|---|
| Molecular Formula | C6H4BrFMg | Melting Point | 5ºC |
|---|
| MSDS | / | Flash Point | -40 °F |
|---|
Names
| Name | magnesium,fluorobenzene,bromide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.043 g/mL at 25ºC |
|---|
| Boiling Point | 66ºC |
|---|
| Melting Point | 5ºC |
|---|
| Molecular Formula | C6H4BrFMg |
|---|
| Molecular Weight | 199.303 |
|---|
| Flash Point | -40 °F |
|---|
| Exact Mass | 197.933075 |
|---|
| LogP | 2.47150 |
|---|
| InChIKey | BRKADVNLTRCLOW-UHFFFAOYSA-M |
|---|
| SMILES | Fc1cc[c-]cc1.[Br-].[Mg+2] |
|---|
| Storage condition | Flammables + water-Freezer (-20°C)e area |
|---|
| Water Solubility | It reacts violently with water. |
|---|
Safety Information
| Hazard Codes | F+: Highly flammable;C: Corrosive;F: Flammable; |
|---|
| Risk Phrases | R12 |
|---|
| Safety Phrases | 16-26-36/37/39-43-45-7/8-33 |
|---|
| RIDADR | UN 2924 3 |
|---|
| WGK Germany | 1 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| MFCD00009667 |
| 4-fluorophenylmagnesium bromide |
| 4-Fluorophenylmagnesiumbromide |
| 4-FC6H4MgBr |
| p-FC6H4MgBr |
| 4-Fluorophenylmagnesium bromide solution |
| Bromo(4-fluorophenyl)magnesium |
| Magnesium, bromo(4-fluorophenyl)- |
| p-Fluorophenylmagnesium bromide |
| 4-Fluorophenylmagnesium bromide |
