Introduction：Basic information about CAS 3588-60-1|Z-DL-Leu-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-DL-Leu-OH |
|---|
| CAS Number | 3588-60-1 | Molecular Weight | 265.305 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 442.8±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H19NO4 | Melting Point | 54ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 221.6±26.8 °C |
|---|
Names
| Name | N-Carbobenzoxy-DL-Leucine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 442.8±38.0 °C at 760 mmHg |
|---|
| Melting Point | 54ºC |
|---|
| Molecular Formula | C14H19NO4 |
|---|
| Molecular Weight | 265.305 |
|---|
| Flash Point | 221.6±26.8 °C |
|---|
| Exact Mass | 265.131409 |
|---|
| PSA | 79.12000 |
|---|
| LogP | 3.12 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | USPFMEKVPDBMCG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(Benzyloxycarbonyl)-L-leucine (N-(Benzyloxycarbonyl)leucine |
| (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid |
| N-Benzyloxycarbonyl-L-leucine |
| Cbz-L-Leu-OH |
| Carbobenzoxyleucine |
| N-(Benzyloxycarbonyl)-L-leucine N-(B |
| (S)-2-(((Benzyloxy)carbonyl)amino)-4-methylpentanoic acid |
| Z-Leu-OH |
| N-Benzyloxycarbonylleucine |
| L-Leucine, N-[(phenylmethoxy)carbonyl]- |
| N-Cbz-L-leucine |
| N-Cbz-DL-leucine |
| MFCD00065129 |
| Benzyloxycarbonyl-L-leucine |
| N-[(Benzyloxy)carbonyl]-L-leucine |
| Z-L-Leucine |
| N-Carbobenzyloxy-L-leucine |
| Benzyloxycarbonylleucine |
| dl-Leucine, N-[(phenylmethoxy)carbonyl]- |
| N-[(Benzyloxy)carbonyl]leucine |
| N-Carbobenzoxy-DL-leucine |
| Cbz-L-leucine |
| 4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid |
| Z-DL-Leu-OH |
| Leucine, N-[(phenylmethoxy)carbonyl]- |
| N-Carbobenzoxy-L-leucine |
