Introduction:Basic information about CAS 359436-90-1|7-Methoxycoumarin-4-acetyl-L-proline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Methoxycoumarin-4-acetyl-L-proline |
|---|
| CAS Number | 359436-90-1 | Molecular Weight | 331.32000 |
|---|
| Density | 1.389g/cm3 | Boiling Point | 618.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17NO6 | Melting Point | 95-97ºC |
|---|
| MSDS | / | Flash Point | 328ºC |
|---|
Names
| Name | 7-methoxycoumarin-4-acetyl-l-proline |
|---|
Chemical & Physical Properties
| Density | 1.389g/cm3 |
|---|
| Boiling Point | 618.7ºC at 760 mmHg |
|---|
| Melting Point | 95-97ºC |
|---|
| Molecular Formula | C17H17NO6 |
|---|
| Molecular Weight | 331.32000 |
|---|
| Flash Point | 328ºC |
|---|
| Exact Mass | 331.10600 |
|---|
| PSA | 97.05000 |
|---|
| LogP | 1.35760 |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | SEFOAEFTUYEMLH-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(CC(=O)N3CCCC3C(=O)O)cc(=O)oc2c1 |
|---|