Introduction：Basic information about CAS 67828-58-4|1-(2-Methyl-4-nitrophenyl)pyrrolidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2-Methyl-4-nitrophenyl)pyrrolidine |
|---|
| CAS Number | 67828-58-4 | Molecular Weight | 206.24100 |
|---|
| Density | 1.198g/cm3 | Boiling Point | 365.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H14N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.8ºC |
|---|
Names
| Name | 1-(2-Methyl-4-nitrophenyl)pyrrolidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.198g/cm3 |
|---|
| Boiling Point | 365.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H14N2O2 |
|---|
| Molecular Weight | 206.24100 |
|---|
| Flash Point | 174.8ºC |
|---|
| Exact Mass | 206.10600 |
|---|
| PSA | 49.06000 |
|---|
| LogP | 3.09160 |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | GUZLPJVFYLEHSV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1CCCC1 |
|---|
Synonyms
| 2-Pyrrolidino-5-nitrotoluene |
| 5-Nitro-2-(1-pyrrolidinyl)toluene |
