Introduction：Basic information about CAS 6786-84-1|alpha,alpha-bis[4-(dimethylamino)phenyl]-4-(ethylamino)naphthalene-1-methanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | alpha,alpha-bis[4-(dimethylamino)phenyl]-4-(ethylamino)naphthalene-1-methanol |
|---|
| CAS Number | 6786-84-1 | Molecular Weight | 369.32700 |
|---|
| Density | 1.168 | Boiling Point | 646.4ºC at 760 mmHg |
|---|
| Molecular Formula | C15H19N3O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 344.8ºC |
|---|
Names
| Name | Solvent Blue 6 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.168 |
|---|
| Boiling Point | 646.4ºC at 760 mmHg |
|---|
| Molecular Formula | C15H19N3O8 |
|---|
| Molecular Weight | 369.32700 |
|---|
| Flash Point | 344.8ºC |
|---|
| Exact Mass | 369.11700 |
|---|
| PSA | 149.04000 |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | POGFPZCWAIFSIW-UHFFFAOYSA-N |
|---|
| SMILES | CCNc1ccc(C(O)(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)c2ccccc12 |
|---|
Synonyms
| (4-ethylamino-[1]naphthyl)-bis-(4-dimethylamino-phenyl)-methanol |
| (4-Aethylamino-[1]naphthyl)-bis-(4-dimethylamino-phenyl)-methan |
| (4-ethylamino-[1]naphthyl)-bis-(4-dimethylamino-phenyl)-methane |
| 1-Naphthalenamine,4-[bis[4-(dimethylamino)phenyl]methyl]-N-ethyl |
| (4-Aethylamino-[1]naphthyl)-bis-(4-dimethylamino-phenyl)-methanol |
