Introduction:Basic information about CAS 67990-05-0|N-(5-chloro-2-methoxyphenyl)-3-hydroxy-4-[[2-methoxy-5-[(phenylamino)carbonyl], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(5-chloro-2-methoxyphenyl)-3-hydroxy-4-[[2-methoxy-5-[(phenylamino)carbonyl]phenyl]azo]naphthalene-2-carboxamide |
|---|
| CAS Number | 67990-05-0 | Molecular Weight | 581.01800 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 696ºC at 760 mmHg |
|---|
| Molecular Formula | C32H25ClN4O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4Z)-N-(5-chloro-2-methoxyphenyl)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-3-oxonaphthalene-2-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 696ºC at 760 mmHg |
|---|
| Molecular Formula | C32H25ClN4O5 |
|---|
| Molecular Weight | 581.01800 |
|---|
| Exact Mass | 580.15100 |
|---|
| PSA | 121.61000 |
|---|
| LogP | 8.28200 |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | IBHCUBFBUGYOHF-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1N=Nc1c(O)c(C(=O)Nc2cc(Cl)ccc2OC)cc2ccccc12 |
|---|