Introduction：Basic information about CAS 68462-57-7|4-Nitrophenyl2-O-(a-D-mannopyranosyl)-a-D-mannopyranoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Nitrophenyl2-O-(a-D-mannopyranosyl)-a-D-mannopyranoside |
|---|
| CAS Number | 68462-57-7 | Molecular Weight | 463.39000 |
|---|
| Density | 1.7g/cm3 | Boiling Point | 795.6ºC at 760 mmHg |
|---|
| Molecular Formula | C18H25NO13 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 435ºC |
|---|
Names
| Name | 4-Nitrophenyl 2-O-(a-D-mannopyranosyl)-a-D-mannopyranoside |
|---|
Chemical & Physical Properties
| Density | 1.7g/cm3 |
|---|
| Boiling Point | 795.6ºC at 760 mmHg |
|---|
| Molecular Formula | C18H25NO13 |
|---|
| Molecular Weight | 463.39000 |
|---|
| Flash Point | 435ºC |
|---|
| Exact Mass | 463.13300 |
|---|
| PSA | 224.35000 |
|---|
| Index of Refraction | 1.67 |
|---|
| InChIKey | ZGWCYKZKLZNQQX-TZXJRDDMSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)cc1 |
|---|
