Introduction:Basic information about CAS 688031-83-6|Butanoic acid, 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-3-methyl-,(2S), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butanoic acid, 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-3-methyl-,(2S)- |
|---|
| CAS Number | 688031-83-6 | Molecular Weight | 263.24600 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 435.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 217.4ºC |
|---|
Names
| Name | Butanoic acid, 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-3-methyl-,(2S) |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 435.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13NO5 |
|---|
| Molecular Weight | 263.24600 |
|---|
| Flash Point | 217.4ºC |
|---|
| Exact Mass | 263.07900 |
|---|
| PSA | 83.91000 |
|---|
| LogP | 1.26130 |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | XWFIRGMUEUYWAL-JTQLQIEISA-N |
|---|
| SMILES | CC(C)C(ON1C(=O)c2ccccc2C1=O)C(=O)O |
|---|