Introduction:Basic information about CAS 6898-97-1|Diethylstilbestrol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diethylstilbestrol |
|---|
| CAS Number | 6898-97-1 | Molecular Weight | 268.350 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 407.1±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H20O2 | Melting Point | 170-172ºC |
|---|
| MSDS | / | Flash Point | 186.9±17.8 °C |
|---|
Names
| Name | Diethylstilbestrol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 407.1±25.0 °C at 760 mmHg |
|---|
| Melting Point | 170-172ºC |
|---|
| Molecular Formula | C18H20O2 |
|---|
| Molecular Weight | 268.350 |
|---|
| Flash Point | 186.9±17.8 °C |
|---|
| Exact Mass | 268.146332 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 5.93 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | RGLYKWWBQGJZGM-UHFFFAOYSA-N |
|---|
| SMILES | CCC(=C(CC)c1ccc(O)cc1)c1ccc(O)cc1 |
|---|
Safety Information
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
|---|
| Risk Phrases | R45;R61;R36/37/38;R51/53 |
|---|
| Safety Phrases | S53-S36/37/39-S45-S60-S61 |
|---|
| RIDADR | UN 3077 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | WJ5600000 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 9.0 |
|---|
| HS Code | 2942000000 |
|---|
Customs
Synonyms
| (Z)-4,4'-(1,2-Diethyl-1,2-ethylenediyl)bisphenol |
| Phenol, 4,4'-[(Z)-1,2-diethyl-1,2-ethenediyl]bis- |
| 4,4'-[(3Z)-3-Hexene-3,4-diyl]diphenol |
| 4,4'-(3Z)-hex-3-ene-3,4-diyldiphenol |
| cis-α,α'-Diethyl-4,4'-stilbenediol |
| 3,4-Bis-<4-chlor-phenyl>-cyclopentanon |
| MFCD00002373 |
| EINECS 200-278-5 |
| diethylstilboestrol |
| 3,4-bis(4-hydroxyphenyl)hex-3-ene |
| 4,4'-Stilbenediol, α,α'-diethyl-, (Z)- |
| Cyclopentanone,3,4-bis(p-chlorophenyl) |
| diethylstilbesterol |
| Cyclopentanone,4-bis(p-chlorophenyl) |