Introduction：Basic information about CAS 70904-57-3|(D-Arg2)-Kyotorphin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (D-Arg2)-Kyotorphin |
|---|
| CAS Number | 70904-57-3 | Molecular Weight | 337.374 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C15H23N5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (D-Arg2)-Kyotorphin Acetate Salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Molecular Formula | C15H23N5O4 |
|---|
| Molecular Weight | 337.374 |
|---|
| Exact Mass | 337.175018 |
|---|
| PSA | 174.55000 |
|---|
| LogP | -0.71 |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | JXNRXNCCROJZFB-NWDGAFQWSA-N |
|---|
| SMILES | NC(N)=NCCCC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
|---|
Safety Information
Synonyms
| D-Arginine,L-tyrosyl |
| D-Ornithine, L-tyrosyl-N-(diaminomethylene)- |
| L-Tyr-L-Arg |
| D-Arginine, N2-L-tyrosyl-, trans- |
| D-Kyotorphin |
| (D-Arg2)Kyotorphin |
| [3H]-Kyotorphin |
| L-tyrosyl-L-arginine |
| L-Tyrosyl-D-arginine |
| L-Tyrosyl-N-(diaminomethylene)-D-ornithine |
| H-L-Tyr-D-Arg-OH |
| (D-Arg2)-Kyotorphin |
| (2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
