Introduction:Basic information about CAS 14531-47-6|Bergenin pentaacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bergenin pentaacetate |
|---|
| CAS Number | 14531-47-6 | Molecular Weight | 538.455 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 582.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H26O14 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.5±30.2 °C |
|---|
Names
| Name | (2R,3R,4R,4aS,10bS)-2-(Acetoxymethyl)-9-methoxy-6-oxo-2,3,4,4a,6, 10b-hexahydropyrano[3,2-c]isochromene-3,4,8,10-tetrayl tetraaceta te |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 582.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H26O14 |
|---|
| Molecular Weight | 538.455 |
|---|
| Flash Point | 247.5±30.2 °C |
|---|
| Exact Mass | 538.132263 |
|---|
| PSA | 176.26000 |
|---|
| LogP | 0.77 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | NCBOXCFFSWALMZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1c(OC(C)=O)cc2c(c1OC(C)=O)C1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC2=O |
|---|
Safety Information
Synonyms
| berberoline chloride |
| 2,3-methylenedioxy-9-hydroxy-10-methoxyprotoberberine chloride |
| Berberrubine chloride |
| Pyrano[3,2-c][2]benzopyran-6(2H)-one, 3,4,8,10-tetrakis(acetyloxy)-2-[(acetyloxy)methyl]-3,4,4a,10b-tetrahydro-9-methoxy-, (2R,3R,4R,4aS,10bS)- |
| Beroline chloride |
| berberrubine hydrochloride |
| bergenin 3,4,8,10,11-pentaacetate |
| beberrubine chloride |
| 9-Demethoxy-9-hydroxyberberinium chloride |
| penta-O-acetyl bergenin |
| Bergenin-pentaacetat |
| Chileninone |
| hydrochloride berberrubine |
| Berberubine hydrochloride |
| (2R,3R,4R,4aS,10bS)-2-(Acetoxymethyl)-9-methoxy-6-oxo-2,3,4,4a,6,10b-hexahydropyrano[3,2-c]isochromene-3,4,8,10-tetrayl tetraacetate |
| 3,4,8,10,11-penta-O-acetylbergenin |
| 9-Berberoline chloride |