Introduction：Basic information about CAS 118555-84-3|Floribundone 1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Floribundone 1 |
|---|
| CAS Number | 118555-84-3 | Molecular Weight | 566.511 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 869.8±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C32H22O10 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 289.2±27.8 °C |
|---|
Names
| Name | [1,2'-Bianthracene]-9,9',10,10'-tetrone,1',4,5,8'-tetrahydroxy-2,3'-dimethoxy-6',7-dimethyl-, (1R)- (9CI) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 869.8±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C32H22O10 |
|---|
| Molecular Weight | 566.511 |
|---|
| Flash Point | 289.2±27.8 °C |
|---|
| Exact Mass | 566.121277 |
|---|
| PSA | 167.66000 |
|---|
| LogP | 9.09 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.725 |
|---|
| InChIKey | BJHQTGSKKZLDSE-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2c(c(O)c1-c1c(OC)cc(O)c3c1C(=O)c1cc(C)cc(O)c1C3=O)C(=O)c1c(O)cc(C)cc1C2=O |
|---|
Safety Information
Synonyms
| [1,2'-Bianthracene]-9,9',10,10'-tetrone, 1',4,5,8'-tetrahydroxy-2,3'-dimethoxy-6',7-dimethyl- |
| 1',4,5,8'-Tetrahydroxy-2,3'-dimethoxy-6',7-dimethyl-1,2'-bianthracene-9,9',10,10'-tetrone |
| Floribundone 1 |
| 5,7'-biphyscion |
| [1,2'-Bianthracene]-9,9',10,10'-tetrone,1',4,5,8'-tetrahydroxy-2,3'-dimethoxy-6',7-dimethyl-, (1R)- |
| 2-(2-Phenoxyphenyl)ethanamine |
