Introduction：Basic information about CAS 1215780-15-6|α-Desmethyl Anastrozole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | α-Desmethyl Anastrozole |
|---|
| CAS Number | 1215780-15-6 | Molecular Weight | 279.340 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 477.5±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H17N5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 242.6±31.5 °C |
|---|
Names
| Name | α-Desmethyl Anastrozole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 477.5±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H17N5 |
|---|
| Molecular Weight | 279.340 |
|---|
| Flash Point | 242.6±31.5 °C |
|---|
| Exact Mass | 279.148407 |
|---|
| PSA | 78.29000 |
|---|
| LogP | 0.62 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | LXXANTDQIIXQBZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C#N)c1cc(Cn2cncn2)cc(C(C)(C)C#N)c1 |
|---|
Synonyms
| 2-[3-(1-cyanoethyl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile |
| 1,3-Benzenediacetonitrile, α,α,α-trimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)- |
| 2-[3-(1-Cyanoethyl)-5-(1H-1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile |
| Anastrozole Impurity 6 |
