Introduction：Basic information about CAS 14062-26-1|(p-Phenoxyphenyl)acetic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (p-Phenoxyphenyl)acetic acid ethyl ester |
|---|
| CAS Number | 14062-26-1 | Molecular Weight | 256.29600 |
|---|
| Density | 1.117g/cm3 | Boiling Point | 353.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 147.3ºC |
|---|
Names
| Name | ethyl 2-(4-phenoxyphenyl)acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.117g/cm3 |
|---|
| Boiling Point | 353.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O3 |
|---|
| Molecular Weight | 256.29600 |
|---|
| Flash Point | 147.3ºC |
|---|
| Exact Mass | 256.11000 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 3.58450 |
|---|
| Vapour Pressure | 3.51E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | CPYLMUNOJSVCRZ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)Cc1ccc(Oc2ccccc2)cc1 |
|---|
Synonyms
| p-Phenoxy-phenylessigsaeure-ethylester |
| Benzeneacetic acid,4-phenoxy-,ethyl ester |
