Introduction：Basic information about CAS 206190-28-5|6-PHENYLQUINAZOLIN-4(3H)-ONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-PHENYLQUINAZOLIN-4(3H)-ONE |
|---|
| CAS Number | 206190-28-5 | Molecular Weight | 222.242 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 492.1±24.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H10N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 251.4±22.9 °C |
|---|
Names
| Name | 6-phenyl-1H-quinazolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 492.1±24.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H10N2O |
|---|
| Molecular Weight | 222.242 |
|---|
| Flash Point | 251.4±22.9 °C |
|---|
| Exact Mass | 222.079315 |
|---|
| PSA | 46.01000 |
|---|
| LogP | 2.53 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | ZQYGHFBZNVXDQB-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]cnc2ccc(-c3ccccc3)cc12 |
|---|
Synonyms
| 6-Phenyl-3H-chinazolin-4-on |
| 6-Phenyl-4(1H)-quinazolinone |
| 4(3H)-Quinazolinone, 6-phenyl- |
| 6-phenyl-3H-quinazolin-4-one |
| 4(3H)-Quinazolinone,6-phenyl- |
