Introduction:Basic information about CAS 191092-05-4|tert-butyl 3-((p-tolylsulfonyloxy)Methyl)piperidine-1-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 3-((p-tolylsulfonyloxy)Methyl)piperidine-1-carboxylate |
|---|
| CAS Number | 191092-05-4 | Molecular Weight | 369.47600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H27NO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-Methyl-2-propanyl 3-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-p iperidinecarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C18H27NO5S |
|---|
| Molecular Weight | 369.47600 |
|---|
| Exact Mass | 369.16100 |
|---|
| PSA | 81.29000 |
|---|
| LogP | 4.36610 |
|---|
| InChIKey | GOCADJZGBKCYNV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCCN(C(=O)OC(C)(C)C)C2)cc1 |
|---|
| Storage condition | 2-8℃ |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| tert-butyl 3-(tosyloxymethyl)piperidine-1-carboxylate |
| 1-t-butoxycarbonyl-3-(p-toluenesulfonyloxymethyl)piperidine |
| 3-(toluene-4-sulfonyloxymethyl)-piperidine-1-carboxylic acid tert-butyl ester |
| 1-BOC-3-IODOMETHYLPIPERIDINE |
| 1-(tert-butoxycarbonyl)-3-iodomethylpiperidine |
| 1-tert-butoxycarbonyl-3-(p-toluenesulfonyloxymethyl)piperidine |
| 3-Iodomethylpiperidine-1-carboxylic acid tert-butyl ester |
| tert-butyl 3-({[(4-methylphenyl)sulfonyl]oxy}methyl)piperidine-1-carboxylate |
| 1-(tert-butoxycarbonyl)-3-(tosyloxymethyl)piperidine |
| (R)-tert-butyl 3-(tosyloxymethyl)piperidine-1-carboxylate |
| 1,4-Diaminecyclohexane |