Introduction：Basic information about CAS 804482-50-6|(3,3,3-Trichloropropyl)triphenylphosphonium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3,3,3-Trichloropropyl)triphenylphosphonium chloride |
|---|
| CAS Number | 804482-50-6 | Molecular Weight | 444.16100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C21H19Cl4P | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | triphenyl(3,3,3-trichloropropyl)phosphanium,chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C21H19Cl4P |
|---|
| Molecular Weight | 444.16100 |
|---|
| Exact Mass | 441.99800 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 2.74480 |
|---|
| InChIKey | CVLBDGPLEYFDOR-UHFFFAOYSA-M |
|---|
| SMILES | ClC(Cl)(Cl)CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| (3,3,3-Trichloropropyl)triphenylphosphonium chloride |
| Phosphonium,triphenyl(3,3,3-trichloropropyl)-,chloride |
| Triphenyl(3,3,3-Trichloropropyl)phosphonium chloride |
