Introduction：Basic information about CAS 67764-52-7|P,P-Diphenyl-N-(phenylmethylene)phosphinic amide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | P,P-Diphenyl-N-(phenylmethylene)phosphinic amide |
|---|
| CAS Number | 67764-52-7 | Molecular Weight | 305.31000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H16NOP | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | N-diphenylphosphoryl-1-phenylmethanimine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C19H16NOP |
|---|
| Molecular Weight | 305.31000 |
|---|
| Exact Mass | 305.09700 |
|---|
| PSA | 39.24000 |
|---|
| LogP | 4.03460 |
|---|
| InChIKey | JLAOYBRAGQKVLX-UHFFFAOYSA-N |
|---|
| SMILES | O=P(N=Cc1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| N-Benzylidene-P,P-diphenylphosphinic amide |
| P,P-diphenyl-N-(benzylidene)phosphinic amide |
| P,P-diphenyl-N-(phenylmethylene)phosphinic amide |
| N-(diphenylphosphinyl)benzaldimine |
| N-Benzyliden-diphenyl-phosphinsaeureamid |
| N-(phenylmethylene)diphenylphosphinamide |
| N-benzylidene-(diphenylphosphioyl)amine |
