Introduction：Basic information about CAS 5943-66-8|1,8-Diphosphonooctane,1,8-octanediylbis-phosphonic acid,C8BPA, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,8-Diphosphonooctane,1,8-octanediylbis-phosphonic acid,C8BPA |
|---|
| CAS Number | 5943-66-8 | Molecular Weight | 274.18800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H20O6P2 | Melting Point | 180-185ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 8-phosphonooctylphosphonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 180-185ºC |
|---|
| Molecular Formula | C8H20O6P2 |
|---|
| Molecular Weight | 274.18800 |
|---|
| Exact Mass | 274.07400 |
|---|
| PSA | 134.68000 |
|---|
| LogP | 1.68240 |
|---|
| InChIKey | VRAVNKVHQXXAQW-UHFFFAOYSA-N |
|---|
| SMILES | O=P(O)(O)CCCCCCCCP(=O)(O)O |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 41 |
|---|
| Safety Phrases | 26-39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Octamethylen-diphosphonsaeure |
| 1,8-octanediylbis-phosphonic acid |
| C8BPA |
| 1,8-Diphosphonooctane,1,8-octanediylbis-phosphonic acid,C8BPA |
| 1,8-Diphosphonooctane |
| 1,8-Octanediphosphonic acid |
| 1,8-octylenediphosphonic acid |
