Introduction:Basic information about CAS 191673-56-0|2-[2-(3,4-dichlorophenyl)morpholin-2-yl]ethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[2-(3,4-dichlorophenyl)morpholin-2-yl]ethanol |
|---|
| CAS Number | 191673-56-0 | Molecular Weight | 276.15900 |
|---|
| Density | 1.283g/cm3 | Boiling Point | 415.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H15Cl2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.2ºC |
|---|
Names
| Name | 2-[2-(3,4-dichlorophenyl)morpholin-2-yl]ethanol |
|---|
Chemical & Physical Properties
| Density | 1.283g/cm3 |
|---|
| Boiling Point | 415.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H15Cl2NO2 |
|---|
| Molecular Weight | 276.15900 |
|---|
| Flash Point | 205.2ºC |
|---|
| Exact Mass | 275.04800 |
|---|
| PSA | 41.49000 |
|---|
| LogP | 2.51970 |
|---|
| Vapour Pressure | 1.18E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | WNVVRSBOQUEIFR-UHFFFAOYSA-N |
|---|
| SMILES | OCCC1(c2ccc(Cl)c(Cl)c2)CNCCO1 |
|---|