Introduction：Basic information about CAS 114776-28-2|Bepafant, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bepafant |
|---|
| CAS Number | 114776-28-2 | Molecular Weight | 467.97100 |
|---|
| Density | 1.59g/cm3 | Boiling Point | 744.5ºC at 760mmHg |
|---|
| Molecular Formula | C23H22ClN5O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 404.1ºC |
|---|
Names
| Name | Bepafant |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.59g/cm3 |
|---|
| Boiling Point | 744.5ºC at 760mmHg |
|---|
| Molecular Formula | C23H22ClN5O2S |
|---|
| Molecular Weight | 467.97100 |
|---|
| Flash Point | 404.1ºC |
|---|
| Exact Mass | 467.11800 |
|---|
| PSA | 100.85000 |
|---|
| LogP | 2.58870 |
|---|
| Vapour Pressure | 4.86E-22mmHg at 25°C |
|---|
| Index of Refraction | 1.792 |
|---|
| InChIKey | FWYVRZOREBYLCY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nnc2n1-c1sc3c(c1C(c1ccccc1Cl)=NC2)CC(C(=O)N1CCOCC1)C3 |
|---|
Synonyms
| 6-(2-chlorophenyl)-8,9-dihydro-1-methyl-8-[(4-morpholinyl)carbonyl]-4H,7H-cyclopenta-[4,5]thieno-[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine |
| Web 2170 |
| 4-((6-(o-chlorophenyl)-8,9-dihydro-1-methyl-4h,7h-cyclopenta[4,5]thieno[3,2-f]-s-triazolo[4,3-a][1,4]diazepin-8-yl)carbonyl)morpholine |
| Bepafanto [INN-Spanish] |
