Introduction：Basic information about CAS 201740-78-5|N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-(1-13C)Alanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-(1-13C)Alanine |
|---|
| CAS Number | 201740-78-5 | Molecular Weight | 190.202 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H15NO4 | Melting Point | 79-83ºC(lit.) |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | N-(tert-Butoxycarbonyl)-L-alanine-1-13C |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Melting Point | 79-83ºC(lit.) |
|---|
| Molecular Formula | C8H15NO4 |
|---|
| Molecular Weight | 190.202 |
|---|
| Exact Mass | 190.103470 |
|---|
| PSA | 79.12000 |
|---|
| LogP | 1.18860 |
|---|
| Index of Refraction | 1.460 |
|---|
| InChIKey | QVHJQCGUWFKTSE-SANWUMGISA-N |
|---|
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)O |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| L-Alanine-1-13C,N-t-Boc derivative |
| L-Alanine-1-C, N-[(1,1-dimethylethoxy)carbonyl]- |
| Boc-Ala-OH-1-13C |
| MFCD00083884 |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-(1-C)alanine |
