Introduction：Basic information about CAS 126062-63-3|Tert-butyl 3-(bromomethyl)benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tert-butyl 3-(bromomethyl)benzoate |
|---|
| CAS Number | 126062-63-3 | Molecular Weight | 271.150 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 321.8±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H15BrO2 | Melting Point | 48-48.5 °C |
|---|
| MSDS | / | Flash Point | 148.4±23.2 °C |
|---|
Names
| Name | tert-butyl 3-(bromomethyl)benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 321.8±25.0 °C at 760 mmHg |
|---|
| Melting Point | 48-48.5 °C |
|---|
| Molecular Formula | C12H15BrO2 |
|---|
| Molecular Weight | 271.150 |
|---|
| Flash Point | 148.4±23.2 °C |
|---|
| Exact Mass | 270.025543 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 4.13 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.538 |
|---|
| InChIKey | FWVVBSNKXPFYMT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)c1cccc(CBr)c1 |
|---|
Safety Information
| Hazard Codes | C |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-bromomethyl-benzoic acid tert-butyl ester |
| Benzoic acid,3-(bromomethyl)-,1,1-dimethylethyl ester |
| tert-butyl-3-(bromomethyl)benzenecarboxylate |
| tert-butyl 3-bromomethylbenzoate |
| Benzoic acid, 3-(bromomethyl)-, 1,1-dimethylethyl ester |
| 3-[Bromomethyl]benzoic acid |
| 2-Methyl-2-propanyl 3-(bromomethyl)benzoate |
| 3-tert-butoxycarbonylbenzyl bromide |
| 1,1-dimethylethyl 3-bromomethylbenzoate |
| [1,1-dimethylethyl] ester |
