Introduction：Basic information about CAS 15210-60-3|3,5,7-Trimethyladamantan-1-amine hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5,7-Trimethyladamantan-1-amine hydrochloride |
|---|
| CAS Number | 15210-60-3 | Molecular Weight | 229.78900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H24ClN | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3,5,7-Trimethyladamantan-1-amine hydrochloride |
|---|
Chemical & Physical Properties
| Molecular Formula | C13H24ClN |
|---|
| Molecular Weight | 229.78900 |
|---|
| Exact Mass | 229.16000 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 4.58650 |
|---|
| InChIKey | HOZQWSJTVWTWDT-UHFFFAOYSA-N |
|---|
| SMILES | CC12CC3(C)CC(C)(C1)CC(N)(C2)C3.Cl |
|---|
Safety Information
Customs
| HS Code | 2921300090 |
|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
