Introduction：Basic information about CAS 7380-44-1|3,7,3',4'-TETRAMETHYLGOSSYPETIN, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,7,3',4'-TETRAMETHYLGOSSYPETIN |
|---|
| CAS Number | 7380-44-1 | Molecular Weight | 374.34100 |
|---|
| Density | 1.387 g/cm3 | Boiling Point | 586.3ºC at760mmHg |
|---|
| Molecular Formula | C19H18O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 215.8ºC |
|---|
Names
| Name | 2-(3,4-dimethoxyphenyl)-5,8-dihydroxy-3,7-dimethoxychromen-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.387 g/cm3 |
|---|
| Boiling Point | 586.3ºC at760mmHg |
|---|
| Molecular Formula | C19H18O8 |
|---|
| Molecular Weight | 374.34100 |
|---|
| Flash Point | 215.8ºC |
|---|
| Exact Mass | 374.10000 |
|---|
| PSA | 107.59000 |
|---|
| LogP | 2.90560 |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | HVUBHXRYARBAGR-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2oc3c(O)c(OC)cc(O)c3c(=O)c2OC)cc1OC |
|---|
Synonyms
| Gossypetin-3,3',4',7-tetramethylether |
| 5,8-Dihydroxy-3,3',4',7,tetramethoxyflavone |
| 3',4'-tetramethoxyflavone |
