Introduction：Basic information about CAS 83721-56-6|N,N'-(9,10-dihydro-4,8-dihydroxy-9,10-dioxoanthracene-1,5-diyl)bis[4-chlor, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N'-(9,10-dihydro-4,8-dihydroxy-9,10-dioxoanthracene-1,5-diyl)bis[4-chlorobenzamide] |
|---|
| CAS Number | 83721-56-6 | Molecular Weight | 547.34200 |
|---|
| Density | 1.621g/cm3 | Boiling Point | 660ºC at 760 mmHg |
|---|
| Molecular Formula | C28H16Cl2N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 353ºC |
|---|
Names
| Name | 4-chloro-N-[5-[(4-chlorobenzoyl)amino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]benzamide |
|---|
Chemical & Physical Properties
| Density | 1.621g/cm3 |
|---|
| Boiling Point | 660ºC at 760 mmHg |
|---|
| Molecular Formula | C28H16Cl2N2O6 |
|---|
| Molecular Weight | 547.34200 |
|---|
| Flash Point | 353ºC |
|---|
| Exact Mass | 546.03900 |
|---|
| PSA | 132.80000 |
|---|
| LogP | 5.83060 |
|---|
| Index of Refraction | 1.778 |
|---|
| InChIKey | RYLATRFYKZMNMK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1ccc(O)c2c1C(=O)c1c(O)ccc(NC(=O)c3ccc(Cl)cc3)c1C2=O)c1ccc(Cl)cc1 |
|---|
