Introduction:Basic information about CAS 83748-27-0|3-Pyridinecarbonitrile, 5-[(4-chloro-2-nitrophenyl) azo]-1,6-dihydro-2-hydroxy, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Pyridinecarbonitrile, 5-[(4-chloro-2-nitrophenyl) azo]-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-1-propyl- |
|---|
| CAS Number | 83748-27-0 | Molecular Weight | 375.76600 |
|---|
| Density | 1.459g/cm3 | Boiling Point | 504.603ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14ClN5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 258.975ºC |
|---|
Names
| Name | (5Z)-5-[(4-chloro-2-nitrophenyl)hydrazinylidene]-4-methyl-2,6-dioxo-1-propylpyridine-3-carbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.459g/cm3 |
|---|
| Boiling Point | 504.603ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14ClN5O4 |
|---|
| Molecular Weight | 375.76600 |
|---|
| Flash Point | 258.975ºC |
|---|
| Exact Mass | 375.07300 |
|---|
| PSA | 131.38000 |
|---|
| LogP | 3.16908 |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | YOXAAGNCYGONKU-UHFFFAOYSA-N |
|---|
| SMILES | CCCn1c(O)c(C#N)c(C)c(N=Nc2ccc(Cl)cc2[N+](=O)[O-])c1=O |
|---|