Introduction:Basic information about CAS 84731-61-3|4-(5-ethyl-1,3-dioxan-2-yl)benzonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(5-ethyl-1,3-dioxan-2-yl)benzonitrile |
|---|
| CAS Number | 84731-61-3 | Molecular Weight | 217.26400 |
|---|
| Density | 1.123g/cm3 | Boiling Point | 352.979ºC at 760 mmHg |
|---|
| Molecular Formula | C13H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(5-ethyl-1,3-dioxan-2-yl)benzonitrile |
|---|
Chemical & Physical Properties
| Density | 1.123g/cm3 |
|---|
| Boiling Point | 352.979ºC at 760 mmHg |
|---|
| Molecular Formula | C13H15NO2 |
|---|
| Molecular Weight | 217.26400 |
|---|
| Exact Mass | 217.11000 |
|---|
| PSA | 42.25000 |
|---|
| LogP | 2.62988 |
|---|
| Index of Refraction | 1.538 |
|---|
| InChIKey | YWSBRIQSYKROHJ-UHFFFAOYSA-N |
|---|
| SMILES | CCC1COC(c2ccc(C#N)cc2)OC1 |
|---|